C20H20ClFN4O2 — CID 53251519
N-[3-[(8aS)-2-amino-4,4a,5,6,7,8-hexahydro-3,1-benzoxazin-8a-yl]-4-fluorophenyl]-5-chloropyridine-2-carboxamide (PubChem CID 53251519) has the molecular formula C20H20ClFN4O2 and a molecular weight of 402.86 g/mol. Its IUPAC name is N-[3-[(8aS)-2-amino-4,4a,5,6,7,8-hexahydro-3,1-benzoxazin-8a-yl]-4-fluorophenyl]-5-chloropyridine-2-carboxamide.
| Compound Name | N-[3-[(8aS)-2-amino-4,4a,5,6,7,8-hexahydro-3,1-benzoxazin-8a-yl]-4-fluorophenyl]-5-chloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 53251519 |
| Molecular Formula | C20H20ClFN4O2 |
| Molecular Weight | 402.86 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | N-[3-[(8aS)-2-amino-4,4a,5,6,7,8-hexahydro-3,1-benzoxazin-8a-yl]-4-fluorophenyl]-5-chloropyridine-2-carboxamide |
| SMILES | NC1=N[C@@]2(c3cc(NC(=O)c4ccc(Cl)cn4)ccc3F)CCCCC2CO1 |
| InChI | InChI=1S/C20H20ClFN4O2/c21-13-4-7-17(24-10-13)18(27)25-14-5-6-16(22)15(9-14)20-8-2-1-3-12(20)11-28-19(23)26-20/h4-7,9-10,12H,1-3,8,11H2,(H2,23,26)(H,25,27)/t12?,20-/m0/s1 |
| InChIKey | CQHHZTPYTGGWKK-UDRWWJRQSA-N |
| XLogP | 3.86 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.86 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |