C21H21ClN4O3 — CID 77323911
N-(2'-amino-3a-methylspiro[1,2,3,9a-tetrahydrocyclopenta[b]chromene-9,4'-5H-1,3-oxazole]-7-yl)-5-chloropyridine-2-carboxamide (PubChem CID 77323911) has the molecular formula C21H21ClN4O3 and a molecular weight of 412.88 g/mol. Its IUPAC name is N-(2'-amino-3a-methylspiro[1,2,3,9a-tetrahydrocyclopenta[b]chromene-9,4'-5H-1,3-oxazole]-7-yl)-5-chloropyridine-2-carboxamide.
| Compound Name | N-(2'-amino-3a-methylspiro[1,2,3,9a-tetrahydrocyclopenta[b]chromene-9,4'-5H-1,3-oxazole]-7-yl)-5-chloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 77323911 |
| Molecular Formula | C21H21ClN4O3 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-(2'-amino-3a-methylspiro[1,2,3,9a-tetrahydrocyclopenta[b]chromene-9,4'-5H-1,3-oxazole]-7-yl)-5-chloropyridine-2-carboxamide |
| SMILES | CC12CCCC1C1(COC(N)=N1)c1cc(NC(=O)c3ccc(Cl)cn3)ccc1O2 |
| InChI | InChI=1S/C21H21ClN4O3/c1-20-8-2-3-17(20)21(11-28-19(23)26-21)14-9-13(5-7-16(14)29-20)25-18(27)15-6-4-12(22)10-24-15/h4-7,9-10,17H,2-3,8,11H2,1H3,(H2,23,26)(H,25,27) |
| InChIKey | IKECTOWANRTDPL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |