C21H22ClN3O3 — CID 67950145
(4aR)-2'-amino-7-(5-chloro-3-pyridinyl)-4a-methylspiro[2,3,4,9a-tetrahydro-1H-xanthene-9,4'-5H-1,3-oxazole]-2-ol (PubChem CID 67950145) has the molecular formula C21H22ClN3O3 and a molecular weight of 399.88 g/mol. Its IUPAC name is (4aR)-2'-amino-7-(5-chloro-3-pyridinyl)-4a-methylspiro[2,3,4,9a-tetrahydro-1H-xanthene-9,4'-5H-1,3-oxazole]-2-ol.
| Compound Name | (4aR)-2'-amino-7-(5-chloro-3-pyridinyl)-4a-methylspiro[2,3,4,9a-tetrahydro-1H-xanthene-9,4'-5H-1,3-oxazole]-2-ol |
|---|---|
| PubChem CID | 67950145 |
| Molecular Formula | C21H22ClN3O3 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | (4aR)-2'-amino-7-(5-chloro-3-pyridinyl)-4a-methylspiro[2,3,4,9a-tetrahydro-1H-xanthene-9,4'-5H-1,3-oxazole]-2-ol |
| SMILES | C[C@@]12CCC(O)CC1C1(COC(N)=N1)c1cc(-c3cncc(Cl)c3)ccc1O2 |
| InChI | InChI=1S/C21H22ClN3O3/c1-20-5-4-15(26)8-18(20)21(11-27-19(23)25-21)16-7-12(2-3-17(16)28-20)13-6-14(22)10-24-9-13/h2-3,6-7,9-10,15,18,26H,4-5,8,11H2,1H3,(H2,23,25)/t15?,18?,20-,21?/m1/s1 |
| InChIKey | SPKOWAILQGCYDT-OPXAELQBSA-N |
| XLogP | 3.25 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |