C21H20ClFN2O3 — CID 67971178
(3S,4aS,9aR)-2'-amino-7-(3-chloro-5-fluorophenyl)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-3-ol (PubChem CID 67971178) has the molecular formula C21H20ClFN2O3 and a molecular weight of 402.85 g/mol. Its IUPAC name is (3S,4aS,9aR)-2'-amino-7-(3-chloro-5-fluorophenyl)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-3-ol.
| Compound Name | (3S,4aS,9aR)-2'-amino-7-(3-chloro-5-fluorophenyl)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-3-ol |
|---|---|
| PubChem CID | 67971178 |
| Molecular Formula | C21H20ClFN2O3 |
| Molecular Weight | 402.85 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (3S,4aS,9aR)-2'-amino-7-(3-chloro-5-fluorophenyl)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-3-ol |
| SMILES | NC1=NC2(CO1)c1cc(-c3cc(F)cc(Cl)c3)ccc1O[C@H]1C[C@@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C21H20ClFN2O3/c22-13-5-12(6-14(23)8-13)11-1-4-18-17(7-11)21(10-27-20(24)25-21)16-3-2-15(26)9-19(16)28-18/h1,4-8,15-16,19,26H,2-3,9-10H2,(H2,24,25)/t15-,16-,19-,21?/m0/s1 |
| InChIKey | BCJAZEQZWHRIKM-AFRWMIOYSA-N |
| XLogP | 3.61 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.85 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |