C24H19F4N3O4 — CID 67971226
[(2S,4aS,9aR)-2'-amino-7-(3-cyano-5-fluorophenyl)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-yl] 2,2,2-trifluoroacetate (PubChem CID 67971226) has the molecular formula C24H19F4N3O4 and a molecular weight of 489.43 g/mol. Its IUPAC name is [(2S,4aS,9aR)-2'-amino-7-(3-cyano-5-fluorophenyl)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2S,4aS,9aR)-2'-amino-7-(3-cyano-5-fluorophenyl)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67971226 |
| Molecular Formula | C24H19F4N3O4 |
| Molecular Weight | 489.43 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | [(2S,4aS,9aR)-2'-amino-7-(3-cyano-5-fluorophenyl)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-yl] 2,2,2-trifluoroacetate |
| SMILES | N#Cc1cc(F)cc(-c2ccc3c(c2)C2(COC(N)=N2)[C@H]2C[C@@H](OC(=O)C(F)(F)F)CC[C@@H]2O3)c1 |
| InChI | InChI=1S/C24H19F4N3O4/c25-15-6-12(10-29)5-14(7-15)13-1-3-19-17(8-13)23(11-33-22(30)31-23)18-9-16(2-4-20(18)35-19)34-21(32)24(26,27)28/h1,3,5-8,16,18,20H,2,4,9,11H2,(H2,30,31)/t16-,18-,20-,23?/m0/s1 |
| InChIKey | OMWRUCBSGMJTTB-WSTYQIMHSA-N |
| XLogP | 3.94 |
| TPSA | 106.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |