C22H20ClN3O3 — CID 77436631
3-(2'-amino-6-hydroxyspiro[5,6,7,8,8a,10a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-yl)-5-chlorobenzonitrile (PubChem CID 77436631) has the molecular formula C22H20ClN3O3 and a molecular weight of 409.87 g/mol. Its IUPAC name is 3-(2'-amino-6-hydroxyspiro[5,6,7,8,8a,10a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-yl)-5-chlorobenzonitrile.
| Compound Name | 3-(2'-amino-6-hydroxyspiro[5,6,7,8,8a,10a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-yl)-5-chlorobenzonitrile |
|---|---|
| PubChem CID | 77436631 |
| Molecular Formula | C22H20ClN3O3 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 3-(2'-amino-6-hydroxyspiro[5,6,7,8,8a,10a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-yl)-5-chlorobenzonitrile |
| SMILES | N#Cc1cc(Cl)cc(-c2ccc3c(c2)C2(COC(N)=N2)C2CCC(O)CC2O3)c1 |
| InChI | InChI=1S/C22H20ClN3O3/c23-15-6-12(10-24)5-14(7-15)13-1-4-19-18(8-13)22(11-28-21(25)26-22)17-3-2-16(27)9-20(17)29-19/h1,4-8,16-17,20,27H,2-3,9,11H2,(H2,25,26) |
| InChIKey | UIEORGHPOOOTAY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 100.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |