C20H20FN3O3 — CID 67949956
(4aR)-2'-amino-7-(2-fluoro-3-pyridinyl)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-3-ol (PubChem CID 67949956) has the molecular formula C20H20FN3O3 and a molecular weight of 369.40 g/mol. Its IUPAC name is (4aR)-2'-amino-7-(2-fluoro-3-pyridinyl)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-3-ol.
| Compound Name | (4aR)-2'-amino-7-(2-fluoro-3-pyridinyl)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-3-ol |
|---|---|
| PubChem CID | 67949956 |
| Molecular Formula | C20H20FN3O3 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (4aR)-2'-amino-7-(2-fluoro-3-pyridinyl)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-3-ol |
| SMILES | NC1=NC2(CO1)c1cc(-c3cccnc3F)ccc1O[C@@H]1CC(O)CCC12 |
| InChI | InChI=1S/C20H20FN3O3/c21-18-13(2-1-7-23-18)11-3-6-16-15(8-11)20(10-26-19(22)24-20)14-5-4-12(25)9-17(14)27-16/h1-3,6-8,12,14,17,25H,4-5,9-10H2,(H2,22,24)/t12?,14?,17-,20?/m1/s1 |
| InChIKey | YRUPFAHRPKSKAP-UKTDKWROSA-N |
| XLogP | 2.35 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|