C21H21F3N4O2 — CID 88536599
(4aS,10aR)-2-(2,2-difluoroethyl)-8-(2-fluoro-3-pyridinyl)spiro[3,4,4a,10a-tetrahydro-1H-chromeno[3,2-c]pyridine-10,4'-5H-1,3-oxazole]-2'-amine (PubChem CID 88536599) has the molecular formula C21H21F3N4O2 and a molecular weight of 418.42 g/mol. Its IUPAC name is (4aS,10aR)-2-(2,2-difluoroethyl)-8-(2-fluoro-3-pyridinyl)spiro[3,4,4a,10a-tetrahydro-1H-chromeno[3,2-c]pyridine-10,4'-5H-1,3-oxazole]-2'-amine.
| Compound Name | (4aS,10aR)-2-(2,2-difluoroethyl)-8-(2-fluoro-3-pyridinyl)spiro[3,4,4a,10a-tetrahydro-1H-chromeno[3,2-c]pyridine-10,4'-5H-1,3-oxazole]-2'-amine |
|---|---|
| PubChem CID | 88536599 |
| Molecular Formula | C21H21F3N4O2 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (4aS,10aR)-2-(2,2-difluoroethyl)-8-(2-fluoro-3-pyridinyl)spiro[3,4,4a,10a-tetrahydro-1H-chromeno[3,2-c]pyridine-10,4'-5H-1,3-oxazole]-2'-amine |
| SMILES | NC1=NC2(CO1)c1cc(-c3cccnc3F)ccc1O[C@H]1CCN(CC(F)F)C[C@@H]12 |
| InChI | InChI=1S/C21H21F3N4O2/c22-18(23)10-28-7-5-17-15(9-28)21(11-29-20(25)27-21)14-8-12(3-4-16(14)30-17)13-2-1-6-26-19(13)24/h1-4,6,8,15,17-18H,5,7,9-11H2,(H2,25,27)/t15-,17-,21?/m0/s1 |
| InChIKey | YRIKIAYBPNLJSI-PHIGLHEMSA-N |
| XLogP | 2.78 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|