C21H20F2N2O3 — CID 67970558
(2S,4aS,9aR)-2'-amino-7-(3,5-difluorophenyl)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-ol (PubChem CID 67970558) has the molecular formula C21H20F2N2O3 and a molecular weight of 386.40 g/mol. Its IUPAC name is (2S,4aS,9aR)-2'-amino-7-(3,5-difluorophenyl)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-ol.
| Compound Name | (2S,4aS,9aR)-2'-amino-7-(3,5-difluorophenyl)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-ol |
|---|---|
| PubChem CID | 67970558 |
| Molecular Formula | C21H20F2N2O3 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (2S,4aS,9aR)-2'-amino-7-(3,5-difluorophenyl)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-ol |
| SMILES | NC1=NC2(CO1)c1cc(-c3cc(F)cc(F)c3)ccc1O[C@H]1CC[C@H](O)C[C@@H]12 |
| InChI | InChI=1S/C21H20F2N2O3/c22-13-5-12(6-14(23)8-13)11-1-3-18-16(7-11)21(10-27-20(24)25-21)17-9-15(26)2-4-19(17)28-18/h1,3,5-8,15,17,19,26H,2,4,9-10H2,(H2,24,25)/t15-,17-,19-,21?/m0/s1 |
| InChIKey | GBMJYVPKQPTYOQ-AUABHZGBSA-N |
| XLogP | 3.09 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |