C26H26ClN3O3 — CID 77436601
3-(2'-amino-7-cyclobutyloxyspiro[5,6,7,8,8a,10a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-yl)-5-chlorobenzonitrile (PubChem CID 77436601) has the molecular formula C26H26ClN3O3 and a molecular weight of 463.97 g/mol. Its IUPAC name is 3-(2'-amino-7-cyclobutyloxyspiro[5,6,7,8,8a,10a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-yl)-5-chlorobenzonitrile.
| Compound Name | 3-(2'-amino-7-cyclobutyloxyspiro[5,6,7,8,8a,10a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-yl)-5-chlorobenzonitrile |
|---|---|
| PubChem CID | 77436601 |
| Molecular Formula | C26H26ClN3O3 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 3-(2'-amino-7-cyclobutyloxyspiro[5,6,7,8,8a,10a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-yl)-5-chlorobenzonitrile |
| SMILES | N#Cc1cc(Cl)cc(-c2ccc3c(c2)C2(COC(N)=N2)C2CC(OC4CCC4)CCC2O3)c1 |
| InChI | InChI=1S/C26H26ClN3O3/c27-18-9-15(13-28)8-17(10-18)16-4-6-23-21(11-16)26(14-31-25(29)30-26)22-12-20(5-7-24(22)33-23)32-19-2-1-3-19/h4,6,8-11,19-20,22,24H,1-3,5,7,12,14H2,(H2,29,30) |
| InChIKey | IUTXCGSDZSNAAH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |