C23H26N4O3 — CID 77436585
2-(cyclopropylmethoxy)-7-pyrimidin-5-ylspiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2'-amine (PubChem CID 77436585) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is 2-(cyclopropylmethoxy)-7-pyrimidin-5-ylspiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2'-amine.
| Compound Name | 2-(cyclopropylmethoxy)-7-pyrimidin-5-ylspiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2'-amine |
|---|---|
| PubChem CID | 77436585 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 2-(cyclopropylmethoxy)-7-pyrimidin-5-ylspiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2'-amine |
| SMILES | NC1=NC2(CO1)c1cc(-c3cncnc3)ccc1OC1CCC(OCC3CC3)CC12 |
| InChI | InChI=1S/C23H26N4O3/c24-22-27-23(12-29-22)18-7-15(16-9-25-13-26-10-16)3-5-20(18)30-21-6-4-17(8-19(21)23)28-11-14-1-2-14/h3,5,7,9-10,13-14,17,19,21H,1-2,4,6,8,11-12H2,(H2,24,27) |
| InChIKey | RTGATTDXWRFKGN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |