C17H21BrN2O3 — CID 67607126
(4aS,9aR)-7-bromo-2-ethoxyspiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2'-amine (PubChem CID 67607126) has the molecular formula C17H21BrN2O3 and a molecular weight of 381.27 g/mol. Its IUPAC name is (4aS,9aR)-7-bromo-2-ethoxyspiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2'-amine.
| Compound Name | (4aS,9aR)-7-bromo-2-ethoxyspiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2'-amine |
|---|---|
| PubChem CID | 67607126 |
| Molecular Formula | C17H21BrN2O3 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | (4aS,9aR)-7-bromo-2-ethoxyspiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2'-amine |
| SMILES | CCOC1CC[C@@H]2Oc3ccc(Br)cc3C3(COC(N)=N3)[C@H]2C1 |
| InChI | InChI=1S/C17H21BrN2O3/c1-2-21-11-4-6-15-13(8-11)17(9-22-16(19)20-17)12-7-10(18)3-5-14(12)23-15/h3,5,7,11,13,15H,2,4,6,8-9H2,1H3,(H2,19,20)/t11?,13-,15-,17?/m0/s1 |
| InChIKey | BUYIKOIREQKMCL-GPTZSLLOSA-N |
| XLogP | 2.96 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |