C24H26ClN3O3 — CID 67970870
(4aS,9aR)-7-(5-chloro-3-pyridinyl)-2-(cyclopropylmethoxy)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2'-amine (PubChem CID 67970870) has the molecular formula C24H26ClN3O3 and a molecular weight of 439.94 g/mol. Its IUPAC name is (4aS,9aR)-7-(5-chloro-3-pyridinyl)-2-(cyclopropylmethoxy)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2'-amine.
| Compound Name | (4aS,9aR)-7-(5-chloro-3-pyridinyl)-2-(cyclopropylmethoxy)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2'-amine |
|---|---|
| PubChem CID | 67970870 |
| Molecular Formula | C24H26ClN3O3 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | (4aS,9aR)-7-(5-chloro-3-pyridinyl)-2-(cyclopropylmethoxy)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2'-amine |
| SMILES | NC1=NC2(CO1)c1cc(-c3cncc(Cl)c3)ccc1O[C@H]1CCC(OCC3CC3)C[C@@H]12 |
| InChI | InChI=1S/C24H26ClN3O3/c25-17-7-16(10-27-11-17)15-3-5-21-19(8-15)24(13-30-23(26)28-24)20-9-18(4-6-22(20)31-21)29-12-14-1-2-14/h3,5,7-8,10-11,14,18,20,22H,1-2,4,6,9,12-13H2,(H2,26,28)/t18?,20-,22-,24?/m0/s1 |
| InChIKey | NPQITEAQEAOONQ-ZEDWRHOESA-N |
| XLogP | 4.30 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |