C22H24FN3O3 — CID 67950250
(2S,9aR)-2-ethoxy-7-(2-fluoro-3-pyridinyl)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2'-amine (PubChem CID 67950250) has the molecular formula C22H24FN3O3 and a molecular weight of 397.45 g/mol. Its IUPAC name is (2S,9aR)-2-ethoxy-7-(2-fluoro-3-pyridinyl)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2'-amine.
| Compound Name | (2S,9aR)-2-ethoxy-7-(2-fluoro-3-pyridinyl)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2'-amine |
|---|---|
| PubChem CID | 67950250 |
| Molecular Formula | C22H24FN3O3 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (2S,9aR)-2-ethoxy-7-(2-fluoro-3-pyridinyl)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2'-amine |
| SMILES | CCO[C@H]1CCC2Oc3ccc(-c4cccnc4F)cc3C3(COC(N)=N3)[C@H]2C1 |
| InChI | InChI=1S/C22H24FN3O3/c1-2-27-14-6-8-19-17(11-14)22(12-28-21(24)26-22)16-10-13(5-7-18(16)29-19)15-4-3-9-25-20(15)23/h3-5,7,9-10,14,17,19H,2,6,8,11-12H2,1H3,(H2,24,26)/t14-,17-,19?,22?/m0/s1 |
| InChIKey | UWAPHJUGZVNOMW-DBYZCXDXSA-N |
| XLogP | 3.39 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|