C22H18ClF4N3O4 — CID 67970634
[(2S,4aS,9aR)-2'-amino-7-(5-chloro-2-fluoro-3-pyridinyl)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-yl] 2,2,2-trifluoroacetate (PubChem CID 67970634) has the molecular formula C22H18ClF4N3O4 and a molecular weight of 499.85 g/mol. Its IUPAC name is [(2S,4aS,9aR)-2'-amino-7-(5-chloro-2-fluoro-3-pyridinyl)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2S,4aS,9aR)-2'-amino-7-(5-chloro-2-fluoro-3-pyridinyl)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67970634 |
| Molecular Formula | C22H18ClF4N3O4 |
| Molecular Weight | 499.85 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | [(2S,4aS,9aR)-2'-amino-7-(5-chloro-2-fluoro-3-pyridinyl)spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-yl] 2,2,2-trifluoroacetate |
| SMILES | NC1=NC2(CO1)c1cc(-c3cc(Cl)cnc3F)ccc1O[C@H]1CC[C@H](OC(=O)C(F)(F)F)C[C@@H]12 |
| InChI | InChI=1S/C22H18ClF4N3O4/c23-11-6-13(18(24)29-8-11)10-1-3-16-14(5-10)21(9-32-20(28)30-21)15-7-12(2-4-17(15)34-16)33-19(31)22(25,26)27/h1,3,5-6,8,12,15,17H,2,4,7,9H2,(H2,28,30)/t12-,15-,17-,21?/m0/s1 |
| InChIKey | FGZLZQZRFUGCPF-YLFYSTMASA-N |
| XLogP | 4.12 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.85 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|