C24H21BrF3N3O5 — CID 67970921
3-[(7S,8aR,10aS)-2'-amino-7-hydroxyspiro[5,6,7,8,8a,10a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-yl]-5-bromobenzonitrile;2,2,2-trifluoroacetic acid (PubChem CID 67970921) has the molecular formula C24H21BrF3N3O5 and a molecular weight of 568.35 g/mol. Its IUPAC name is 3-[(7S,8aR,10aS)-2'-amino-7-hydroxyspiro[5,6,7,8,8a,10a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-yl]-5-bromobenzonitrile;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[(7S,8aR,10aS)-2'-amino-7-hydroxyspiro[5,6,7,8,8a,10a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-yl]-5-bromobenzonitrile;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67970921 |
| Molecular Formula | C24H21BrF3N3O5 |
| Molecular Weight | 568.35 g/mol |
| Exact Mass | 567.06 |
| IUPAC Name | 3-[(7S,8aR,10aS)-2'-amino-7-hydroxyspiro[5,6,7,8,8a,10a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-yl]-5-bromobenzonitrile;2,2,2-trifluoroacetic acid |
| SMILES | N#Cc1cc(Br)cc(-c2ccc3c(c2)C2(COC(N)=N2)[C@H]2C[C@@H](O)CC[C@@H]2O3)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H20BrN3O3.C2HF3O2/c23-15-6-12(10-24)5-14(7-15)13-1-3-19-17(8-13)22(11-28-21(25)26-22)18-9-16(27)2-4-20(18)29-19;3-2(4,5)1(6)7/h1,3,5-8,16,18,20,27H,2,4,9,11H2,(H2,25,26);(H,6,7)/t16-,18-,20-,22?;/m0./s1 |
| InChIKey | DKSRMLXAEBFETQ-CPVNVJDPSA-N |
| XLogP | 4.08 |
| TPSA | 138.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |