C23H26N4O2S — CID 67970940
(2S,4aS,9S,9aR)-2-(cyclopropylmethoxy)-7-pyrimidin-5-ylspiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-thiazole]-2'-amine (PubChem CID 67970940) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is (2S,4aS,9S,9aR)-2-(cyclopropylmethoxy)-7-pyrimidin-5-ylspiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-thiazole]-2'-amine.
| Compound Name | (2S,4aS,9S,9aR)-2-(cyclopropylmethoxy)-7-pyrimidin-5-ylspiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-thiazole]-2'-amine |
|---|---|
| PubChem CID | 67970940 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (2S,4aS,9S,9aR)-2-(cyclopropylmethoxy)-7-pyrimidin-5-ylspiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-thiazole]-2'-amine |
| SMILES | NC1=N[C@]2(CS1)c1cc(-c3cncnc3)ccc1O[C@H]1CC[C@H](OCC3CC3)C[C@@H]12 |
| InChI | InChI=1S/C23H26N4O2S/c24-22-27-23(12-30-22)18-7-15(16-9-25-13-26-10-16)3-5-20(18)29-21-6-4-17(8-19(21)23)28-11-14-1-2-14/h3,5,7,9-10,13-14,17,19,21H,1-2,4,6,8,11-12H2,(H2,24,27)/t17-,19-,21-,23+/m0/s1 |
| InChIKey | WZZXBZGFTZFVRE-RAKJYXHLSA-N |
| XLogP | 3.76 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |