C20H19BrClN3O2S — CID 67971161
(4aS,9S,9aR)-2'-amino-7-bromo-2-(5-chloro-3-pyridinyl)spiro[3,4,4a,9a-tetrahydro-1H-xanthene-9,4'-5H-1,3-thiazole]-2-ol (PubChem CID 67971161) has the molecular formula C20H19BrClN3O2S and a molecular weight of 480.82 g/mol. Its IUPAC name is (4aS,9S,9aR)-2'-amino-7-bromo-2-(5-chloro-3-pyridinyl)spiro[3,4,4a,9a-tetrahydro-1H-xanthene-9,4'-5H-1,3-thiazole]-2-ol.
| Compound Name | (4aS,9S,9aR)-2'-amino-7-bromo-2-(5-chloro-3-pyridinyl)spiro[3,4,4a,9a-tetrahydro-1H-xanthene-9,4'-5H-1,3-thiazole]-2-ol |
|---|---|
| PubChem CID | 67971161 |
| Molecular Formula | C20H19BrClN3O2S |
| Molecular Weight | 480.82 g/mol |
| Exact Mass | 479.01 |
| IUPAC Name | (4aS,9S,9aR)-2'-amino-7-bromo-2-(5-chloro-3-pyridinyl)spiro[3,4,4a,9a-tetrahydro-1H-xanthene-9,4'-5H-1,3-thiazole]-2-ol |
| SMILES | NC1=N[C@]2(CS1)c1cc(Br)ccc1O[C@H]1CCC(O)(c3cncc(Cl)c3)C[C@@H]12 |
| InChI | InChI=1S/C20H19BrClN3O2S/c21-12-1-2-16-14(6-12)20(10-28-18(23)25-20)15-7-19(26,4-3-17(15)27-16)11-5-13(22)9-24-8-11/h1-2,5-6,8-9,15,17,26H,3-4,7,10H2,(H2,23,25)/t15-,17-,19?,20+/m0/s1 |
| InChIKey | XBLDDGJNASHQHX-ITQZNNSKSA-N |
| XLogP | 4.20 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.82 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |