C19H20N4OS — CID 67950041
(4aR)-7-pyrimidin-5-ylspiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-thiazole]-2'-amine (PubChem CID 67950041) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is (4aR)-7-pyrimidin-5-ylspiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-thiazole]-2'-amine.
| Compound Name | (4aR)-7-pyrimidin-5-ylspiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-thiazole]-2'-amine |
|---|---|
| PubChem CID | 67950041 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (4aR)-7-pyrimidin-5-ylspiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-thiazole]-2'-amine |
| SMILES | NC1=NC2(CS1)c1cc(-c3cncnc3)ccc1O[C@@H]1CCCCC12 |
| InChI | InChI=1S/C19H20N4OS/c20-18-23-19(10-25-18)14-3-1-2-4-16(14)24-17-6-5-12(7-15(17)19)13-8-21-11-22-9-13/h5-9,11,14,16H,1-4,10H2,(H2,20,23)/t14?,16-,19?/m1/s1 |
| InChIKey | ABUISRBTFAMWHX-NLGTXKQRSA-N |
| XLogP | 3.35 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |