C23H26N4O2S — CID 67971312
(4aR,9aR)-2-(1,3-dioxolan-2-yl)-6-pyrimidin-5-ylspiro[2,3,4,4a,9,9a-hexahydro-1H-anthracene-10,4'-5H-1,3-thiazole]-2'-amine (PubChem CID 67971312) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is (4aR,9aR)-2-(1,3-dioxolan-2-yl)-6-pyrimidin-5-ylspiro[2,3,4,4a,9,9a-hexahydro-1H-anthracene-10,4'-5H-1,3-thiazole]-2'-amine.
| Compound Name | (4aR,9aR)-2-(1,3-dioxolan-2-yl)-6-pyrimidin-5-ylspiro[2,3,4,4a,9,9a-hexahydro-1H-anthracene-10,4'-5H-1,3-thiazole]-2'-amine |
|---|---|
| PubChem CID | 67971312 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (4aR,9aR)-2-(1,3-dioxolan-2-yl)-6-pyrimidin-5-ylspiro[2,3,4,4a,9,9a-hexahydro-1H-anthracene-10,4'-5H-1,3-thiazole]-2'-amine |
| SMILES | NC1=NC2(CS1)c1cc(-c3cncnc3)ccc1C[C@H]1CC(C3OCCO3)CC[C@H]12 |
| InChI | InChI=1S/C23H26N4O2S/c24-22-27-23(12-30-22)19-4-3-16(21-28-5-6-29-21)8-17(19)7-15-2-1-14(9-20(15)23)18-10-25-13-26-11-18/h1-2,9-11,13,16-17,19,21H,3-8,12H2,(H2,24,27)/t16?,17-,19+,23?/m0/s1 |
| InChIKey | DMYYSVDXCNKOIG-WTWLLKEWSA-N |
| XLogP | 3.36 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |