C20H22N4OS — CID 67617895
2'-amino-6-pyrimidin-5-ylspiro[2,3,4,4a,9,9a-hexahydro-1H-anthracene-10,4'-5H-1,3-thiazole]-2-ol (PubChem CID 67617895) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 2'-amino-6-pyrimidin-5-ylspiro[2,3,4,4a,9,9a-hexahydro-1H-anthracene-10,4'-5H-1,3-thiazole]-2-ol.
| Compound Name | 2'-amino-6-pyrimidin-5-ylspiro[2,3,4,4a,9,9a-hexahydro-1H-anthracene-10,4'-5H-1,3-thiazole]-2-ol |
|---|---|
| PubChem CID | 67617895 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2'-amino-6-pyrimidin-5-ylspiro[2,3,4,4a,9,9a-hexahydro-1H-anthracene-10,4'-5H-1,3-thiazole]-2-ol |
| SMILES | NC1=NC2(CS1)c1cc(-c3cncnc3)ccc1CC1CC(O)CCC12 |
| InChI | InChI=1S/C20H22N4OS/c21-19-24-20(10-26-19)17-4-3-16(25)6-14(17)5-13-2-1-12(7-18(13)20)15-8-22-11-23-9-15/h1-2,7-9,11,14,16-17,25H,3-6,10H2,(H2,21,24) |
| InChIKey | NALAUWCEVNSKTR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |