C16H15FN4OS — CID 50903138
(4aS,7aS)-7a-(2-fluoro-5-pyrimidin-5-ylphenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine (PubChem CID 50903138) has the molecular formula C16H15FN4OS and a molecular weight of 330.39 g/mol. Its IUPAC name is (4aS,7aS)-7a-(2-fluoro-5-pyrimidin-5-ylphenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aS,7aS)-7a-(2-fluoro-5-pyrimidin-5-ylphenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 50903138 |
| Molecular Formula | C16H15FN4OS |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | (4aS,7aS)-7a-(2-fluoro-5-pyrimidin-5-ylphenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine |
| SMILES | NC1=N[C@@]2(c3cc(-c4cncnc4)ccc3F)COC[C@H]2CS1 |
| InChI | InChI=1S/C16H15FN4OS/c17-14-2-1-10(11-4-19-9-20-5-11)3-13(14)16-8-22-6-12(16)7-23-15(18)21-16/h1-5,9,12H,6-8H2,(H2,18,21)/t12-,16-/m0/s1 |
| InChIKey | MCJWBNDQNGILDW-LRDDRELGSA-N |
| XLogP | 2.19 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |