C16H14F2N4OS — CID 66861535
7a-(2,4-difluoro-5-pyrimidin-5-ylphenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine (PubChem CID 66861535) has the molecular formula C16H14F2N4OS and a molecular weight of 348.38 g/mol. Its IUPAC name is 7a-(2,4-difluoro-5-pyrimidin-5-ylphenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine.
| Compound Name | 7a-(2,4-difluoro-5-pyrimidin-5-ylphenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 66861535 |
| Molecular Formula | C16H14F2N4OS |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 7a-(2,4-difluoro-5-pyrimidin-5-ylphenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine |
| SMILES | NC1=NC2(c3cc(-c4cncnc4)c(F)cc3F)COCC2CS1 |
| InChI | InChI=1S/C16H14F2N4OS/c17-13-2-14(18)12(1-11(13)9-3-20-8-21-4-9)16-7-23-5-10(16)6-24-15(19)22-16/h1-4,8,10H,5-7H2,(H2,19,22) |
| InChIKey | QHBAUPOOYRGPCQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |