C18H18F2N4S — CID 50903050
(4aR,8aS)-8a-(2,4-difluoro-5-pyrimidin-5-ylphenyl)-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-amine (PubChem CID 50903050) has the molecular formula C18H18F2N4S and a molecular weight of 360.43 g/mol. Its IUPAC name is (4aR,8aS)-8a-(2,4-difluoro-5-pyrimidin-5-ylphenyl)-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-amine.
| Compound Name | (4aR,8aS)-8a-(2,4-difluoro-5-pyrimidin-5-ylphenyl)-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-amine |
|---|---|
| PubChem CID | 50903050 |
| Molecular Formula | C18H18F2N4S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (4aR,8aS)-8a-(2,4-difluoro-5-pyrimidin-5-ylphenyl)-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-amine |
| SMILES | NC1=N[C@@]2(c3cc(-c4cncnc4)c(F)cc3F)CCCC[C@H]2CS1 |
| InChI | InChI=1S/C18H18F2N4S/c19-15-6-16(20)14(5-13(15)11-7-22-10-23-8-11)18-4-2-1-3-12(18)9-25-17(21)24-18/h5-8,10,12H,1-4,9H2,(H2,21,24)/t12-,18-/m0/s1 |
| InChIKey | FWUCLVXFLXBANO-SGTLLEGYSA-N |
| XLogP | 3.87 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |