C14H17FN2S — CID 67478082
8a-(2-fluorophenyl)-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-amine (PubChem CID 67478082) has the molecular formula C14H17FN2S and a molecular weight of 264.37 g/mol. Its IUPAC name is 8a-(2-fluorophenyl)-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-amine.
| Compound Name | 8a-(2-fluorophenyl)-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-amine |
|---|---|
| PubChem CID | 67478082 |
| Molecular Formula | C14H17FN2S |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 8a-(2-fluorophenyl)-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-amine |
| SMILES | NC1=NC2(c3ccccc3F)CCCCC2CS1 |
| InChI | InChI=1S/C14H17FN2S/c15-12-7-2-1-6-11(12)14-8-4-3-5-10(14)9-18-13(16)17-14/h1-2,6-7,10H,3-5,8-9H2,(H2,16,17) |
| InChIKey | SYEVZMZBPICUPI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |