C14H17N3O2S — CID 59621307
(4aR,8aS)-8a-(3-nitrophenyl)-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-amine (PubChem CID 59621307) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is (4aR,8aS)-8a-(3-nitrophenyl)-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-amine.
| Compound Name | (4aR,8aS)-8a-(3-nitrophenyl)-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-amine |
|---|---|
| PubChem CID | 59621307 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | (4aR,8aS)-8a-(3-nitrophenyl)-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-amine |
| SMILES | NC1=N[C@@]2(c3cccc([N+](=O)[O-])c3)CCCC[C@H]2CS1 |
| InChI | InChI=1S/C14H17N3O2S/c15-13-16-14(7-2-1-4-11(14)9-20-13)10-5-3-6-12(8-10)17(18)19/h3,5-6,8,11H,1-2,4,7,9H2,(H2,15,16)/t11-,14+/m0/s1 |
| InChIKey | YBRMMWFBUUTGHX-SMDDNHRTSA-N |
| XLogP | 3.04 |
| TPSA | 81.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|