C14H16FN3O3S — CID 67279118
7a-(2-fluoro-5-nitrophenyl)-5-methoxy-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-amine (PubChem CID 67279118) has the molecular formula C14H16FN3O3S and a molecular weight of 325.37 g/mol. Its IUPAC name is 7a-(2-fluoro-5-nitrophenyl)-5-methoxy-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-amine.
| Compound Name | 7a-(2-fluoro-5-nitrophenyl)-5-methoxy-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 67279118 |
| Molecular Formula | C14H16FN3O3S |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 7a-(2-fluoro-5-nitrophenyl)-5-methoxy-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-amine |
| SMILES | COC1CCC2(c3cc([N+](=O)[O-])ccc3F)N=C(N)SCC12 |
| InChI | InChI=1S/C14H16FN3O3S/c1-21-12-4-5-14(10(12)7-22-13(16)17-14)9-6-8(18(19)20)2-3-11(9)15/h2-3,6,10,12H,4-5,7H2,1H3,(H2,16,17) |
| InChIKey | SAAWVPRESXHYTK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|