C12H12FN3O4 — CID 118399203
(4aR,7aR)-7a-(2-fluoro-5-nitrophenyl)-4,4a,6,7-tetrahydrofuro[3,2-d][1,3]oxazin-2-amine (PubChem CID 118399203) has the molecular formula C12H12FN3O4 and a molecular weight of 281.24 g/mol. Its IUPAC name is (4aR,7aR)-7a-(2-fluoro-5-nitrophenyl)-4,4a,6,7-tetrahydrofuro[3,2-d][1,3]oxazin-2-amine.
| Compound Name | (4aR,7aR)-7a-(2-fluoro-5-nitrophenyl)-4,4a,6,7-tetrahydrofuro[3,2-d][1,3]oxazin-2-amine |
|---|---|
| PubChem CID | 118399203 |
| Molecular Formula | C12H12FN3O4 |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | (4aR,7aR)-7a-(2-fluoro-5-nitrophenyl)-4,4a,6,7-tetrahydrofuro[3,2-d][1,3]oxazin-2-amine |
| SMILES | NC1=N[C@@]2(c3cc([N+](=O)[O-])ccc3F)CCO[C@H]2CO1 |
| InChI | InChI=1S/C12H12FN3O4/c13-9-2-1-7(16(17)18)5-8(9)12-3-4-19-10(12)6-20-11(14)15-12/h1-2,5,10H,3-4,6H2,(H2,14,15)/t10-,12+/m0/s1 |
| InChIKey | MEKICHLHEFDXMY-CMPLNLGQSA-N |
| XLogP | 1.06 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|