C13H14FN3O5 — CID 121468464
[4-ethyl-4-(2-fluoro-5-nitrophenyl)-5,6-dihydro-1,3-oxazin-2-yl]carbamic acid (PubChem CID 121468464) has the molecular formula C13H14FN3O5 and a molecular weight of 311.27 g/mol. Its IUPAC name is [4-ethyl-4-(2-fluoro-5-nitrophenyl)-5,6-dihydro-1,3-oxazin-2-yl]carbamic acid.
| Compound Name | [4-ethyl-4-(2-fluoro-5-nitrophenyl)-5,6-dihydro-1,3-oxazin-2-yl]carbamic acid |
|---|---|
| PubChem CID | 121468464 |
| Molecular Formula | C13H14FN3O5 |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | [4-ethyl-4-(2-fluoro-5-nitrophenyl)-5,6-dihydro-1,3-oxazin-2-yl]carbamic acid |
| SMILES | CCC1(c2cc([N+](=O)[O-])ccc2F)CCOC(NC(=O)O)=N1 |
| InChI | InChI=1S/C13H14FN3O5/c1-2-13(5-6-22-11(16-13)15-12(18)19)9-7-8(17(20)21)3-4-10(9)14/h3-4,7H,2,5-6H2,1H3,(H,15,16)(H,18,19) |
| InChIKey | DHKLNFGTKVMEBT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|