C17H22FN3O6S — CID 90301323
[(2S,3R)-3-(2-fluoro-5-nitrophenyl)-1,1-dihydroxy-3,6,6-trimethyl-2-prop-2-enyl-2H-1,4-thiazin-5-yl]carbamic acid (PubChem CID 90301323) has the molecular formula C17H22FN3O6S and a molecular weight of 415.44 g/mol. Its IUPAC name is [(2S,3R)-3-(2-fluoro-5-nitrophenyl)-1,1-dihydroxy-3,6,6-trimethyl-2-prop-2-enyl-2H-1,4-thiazin-5-yl]carbamic acid.
| Compound Name | [(2S,3R)-3-(2-fluoro-5-nitrophenyl)-1,1-dihydroxy-3,6,6-trimethyl-2-prop-2-enyl-2H-1,4-thiazin-5-yl]carbamic acid |
|---|---|
| PubChem CID | 90301323 |
| Molecular Formula | C17H22FN3O6S |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | [(2S,3R)-3-(2-fluoro-5-nitrophenyl)-1,1-dihydroxy-3,6,6-trimethyl-2-prop-2-enyl-2H-1,4-thiazin-5-yl]carbamic acid |
| SMILES | C=CC[C@H]1[C@@](C)(c2cc([N+](=O)[O-])ccc2F)N=C(NC(=O)O)C(C)(C)S1(O)O |
| InChI | InChI=1S/C17H22FN3O6S/c1-5-6-13-17(4,11-9-10(21(24)25)7-8-12(11)18)20-14(19-15(22)23)16(2,3)28(13,26)27/h5,7-9,13,26-27H,1,6H2,2-4H3,(H,19,20)(H,22,23)/t13-,17+/m0/s1 |
| InChIKey | UFIFHXWSRMCHCI-SUMWQHHRSA-N |
| XLogP | 4.10 |
| TPSA | 145.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|