C13H13FN4O5S — CID 129202135
3-amino-4a-(2-fluoro-5-nitrophenyl)-2-methyl-1,1-dioxo-7,7a-dihydro-5H-cyclopenta[e][1,2,4]thiadiazin-6-one (PubChem CID 129202135) has the molecular formula C13H13FN4O5S and a molecular weight of 356.34 g/mol. Its IUPAC name is 3-amino-4a-(2-fluoro-5-nitrophenyl)-2-methyl-1,1-dioxo-7,7a-dihydro-5H-cyclopenta[e][1,2,4]thiadiazin-6-one.
| Compound Name | 3-amino-4a-(2-fluoro-5-nitrophenyl)-2-methyl-1,1-dioxo-7,7a-dihydro-5H-cyclopenta[e][1,2,4]thiadiazin-6-one |
|---|---|
| PubChem CID | 129202135 |
| Molecular Formula | C13H13FN4O5S |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 3-amino-4a-(2-fluoro-5-nitrophenyl)-2-methyl-1,1-dioxo-7,7a-dihydro-5H-cyclopenta[e][1,2,4]thiadiazin-6-one |
| SMILES | CN1C(N)=NC2(c3cc([N+](=O)[O-])ccc3F)CC(=O)CC2S1(=O)=O |
| InChI | InChI=1S/C13H13FN4O5S/c1-17-12(15)16-13(6-8(19)5-11(13)24(17,22)23)9-4-7(18(20)21)2-3-10(9)14/h2-4,11H,5-6H2,1H3,(H2,15,16) |
| InChIKey | SDNOERWNZDZPFG-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 135.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|