C13H15FN4O4S — CID 118190065
(8R)-8-(2-fluoro-5-nitrophenyl)-5,8-dimethyl-4,4-dioxo-4λ6-thia-5,7-diazaspiro[2.5]oct-6-en-6-amine (PubChem CID 118190065) has the molecular formula C13H15FN4O4S and a molecular weight of 342.35 g/mol. Its IUPAC name is (8R)-8-(2-fluoro-5-nitrophenyl)-5,8-dimethyl-4,4-dioxo-4λ6-thia-5,7-diazaspiro[2.5]oct-6-en-6-amine.
| Compound Name | (8R)-8-(2-fluoro-5-nitrophenyl)-5,8-dimethyl-4,4-dioxo-4λ6-thia-5,7-diazaspiro[2.5]oct-6-en-6-amine |
|---|---|
| PubChem CID | 118190065 |
| Molecular Formula | C13H15FN4O4S |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | (8R)-8-(2-fluoro-5-nitrophenyl)-5,8-dimethyl-4,4-dioxo-4λ6-thia-5,7-diazaspiro[2.5]oct-6-en-6-amine |
| SMILES | CN1C(N)=N[C@](C)(c2cc([N+](=O)[O-])ccc2F)C2(CC2)S1(=O)=O |
| InChI | InChI=1S/C13H15FN4O4S/c1-12(9-7-8(18(19)20)3-4-10(9)14)13(5-6-13)23(21,22)17(2)11(15)16-12/h3-4,7H,5-6H2,1-2H3,(H2,15,16)/t12-/m1/s1 |
| InChIKey | HOQSMGNAWGDCKB-GFCCVEGCSA-N |
| XLogP | 1.07 |
| TPSA | 118.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|