C10H10FN5O2 — CID 154688855
4-(2-fluoro-5-nitrophenyl)-1H-pyrimidine-4,5-diamine (PubChem CID 154688855) has the molecular formula C10H10FN5O2 and a molecular weight of 251.22 g/mol. Its IUPAC name is 4-(2-fluoro-5-nitrophenyl)-1H-pyrimidine-4,5-diamine.
| Compound Name | 4-(2-fluoro-5-nitrophenyl)-1H-pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 154688855 |
| Molecular Formula | C10H10FN5O2 |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 4-(2-fluoro-5-nitrophenyl)-1H-pyrimidine-4,5-diamine |
| SMILES | NC1=CNC=NC1(N)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C10H10FN5O2/c11-8-2-1-6(16(17)18)3-7(8)10(13)9(12)4-14-5-15-10/h1-5H,12-13H2,(H,14,15) |
| InChIKey | XJQQUEQGCAGBGW-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|