C11H12FN3O4S — CID 118073003
(5R)-5-(2-fluoro-5-nitrophenyl)-5-methyl-1,1-dioxo-2,6-dihydro-1,4-thiazin-3-amine (PubChem CID 118073003) has the molecular formula C11H12FN3O4S and a molecular weight of 301.30 g/mol. Its IUPAC name is (5R)-5-(2-fluoro-5-nitrophenyl)-5-methyl-1,1-dioxo-2,6-dihydro-1,4-thiazin-3-amine.
| Compound Name | (5R)-5-(2-fluoro-5-nitrophenyl)-5-methyl-1,1-dioxo-2,6-dihydro-1,4-thiazin-3-amine |
|---|---|
| PubChem CID | 118073003 |
| Molecular Formula | C11H12FN3O4S |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | (5R)-5-(2-fluoro-5-nitrophenyl)-5-methyl-1,1-dioxo-2,6-dihydro-1,4-thiazin-3-amine |
| SMILES | C[C@@]1(c2cc([N+](=O)[O-])ccc2F)CS(=O)(=O)CC(N)=N1 |
| InChI | InChI=1S/C11H12FN3O4S/c1-11(6-20(18,19)5-10(13)14-11)8-4-7(15(16)17)2-3-9(8)12/h2-4H,5-6H2,1H3,(H2,13,14)/t11-/m0/s1 |
| InChIKey | ROIAZLRITUAYCP-NSHDSACASA-N |
| XLogP | 0.73 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|