C14H17F4N3O2S — CID 89095222
(3R,6S)-3-(5-amino-2-fluorophenyl)-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-5-amine (PubChem CID 89095222) has the molecular formula C14H17F4N3O2S and a molecular weight of 367.37 g/mol. Its IUPAC name is (3R,6S)-3-(5-amino-2-fluorophenyl)-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-5-amine.
| Compound Name | (3R,6S)-3-(5-amino-2-fluorophenyl)-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 89095222 |
| Molecular Formula | C14H17F4N3O2S |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | (3R,6S)-3-(5-amino-2-fluorophenyl)-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-5-amine |
| SMILES | C[C@]1(CC(F)(F)F)C(N)=N[C@](C)(c2cc(N)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C14H17F4N3O2S/c1-12(9-5-8(19)3-4-10(9)15)7-24(22,23)13(2,11(20)21-12)6-14(16,17)18/h3-5H,6-7,19H2,1-2H3,(H2,20,21)/t12-,13-/m0/s1 |
| InChIKey | AEVCDHUWLDCDCO-STQMWFEESA-N |
| XLogP | 2.12 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|