C15H22FN3O2S — CID 89095214
(3R,6S)-3-(5-amino-2-fluorophenyl)-3,6-dimethyl-1,1-dioxo-6-propan-2-yl-2H-1,4-thiazin-5-amine (PubChem CID 89095214) has the molecular formula C15H22FN3O2S and a molecular weight of 327.43 g/mol. Its IUPAC name is (3R,6S)-3-(5-amino-2-fluorophenyl)-3,6-dimethyl-1,1-dioxo-6-propan-2-yl-2H-1,4-thiazin-5-amine.
| Compound Name | (3R,6S)-3-(5-amino-2-fluorophenyl)-3,6-dimethyl-1,1-dioxo-6-propan-2-yl-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 89095214 |
| Molecular Formula | C15H22FN3O2S |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (3R,6S)-3-(5-amino-2-fluorophenyl)-3,6-dimethyl-1,1-dioxo-6-propan-2-yl-2H-1,4-thiazin-5-amine |
| SMILES | CC(C)[C@@]1(C)C(N)=N[C@](C)(c2cc(N)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C15H22FN3O2S/c1-9(2)15(4)13(18)19-14(3,8-22(15,20)21)11-7-10(17)5-6-12(11)16/h5-7,9H,8,17H2,1-4H3,(H2,18,19)/t14-,15-/m0/s1 |
| InChIKey | ASLNFVWKKHRNQF-GJZGRUSLSA-N |
| XLogP | 1.82 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|