C15H20FN3O2S — CID 89419817
(8R)-8-(5-amino-2-fluorophenyl)-8-methyl-6,6-dioxo-6λ6-thia-9-azaspiro[4.5]dec-9-en-10-amine (PubChem CID 89419817) has the molecular formula C15H20FN3O2S and a molecular weight of 325.41 g/mol. Its IUPAC name is (8R)-8-(5-amino-2-fluorophenyl)-8-methyl-6,6-dioxo-6λ6-thia-9-azaspiro[4.5]dec-9-en-10-amine.
| Compound Name | (8R)-8-(5-amino-2-fluorophenyl)-8-methyl-6,6-dioxo-6λ6-thia-9-azaspiro[4.5]dec-9-en-10-amine |
|---|---|
| PubChem CID | 89419817 |
| Molecular Formula | C15H20FN3O2S |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (8R)-8-(5-amino-2-fluorophenyl)-8-methyl-6,6-dioxo-6λ6-thia-9-azaspiro[4.5]dec-9-en-10-amine |
| SMILES | C[C@@]1(c2cc(N)ccc2F)CS(=O)(=O)C2(CCCC2)C(N)=N1 |
| InChI | InChI=1S/C15H20FN3O2S/c1-14(11-8-10(17)4-5-12(11)16)9-22(20,21)15(13(18)19-14)6-2-3-7-15/h4-5,8H,2-3,6-7,9,17H2,1H3,(H2,18,19)/t14-/m0/s1 |
| InChIKey | JNDSMEHECBJJHD-AWEZNQCLSA-N |
| XLogP | 1.72 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|