C13H17F2N3O2S — CID 89095188
(3R)-3-(3-amino-2,6-difluorophenyl)-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 89095188) has the molecular formula C13H17F2N3O2S and a molecular weight of 317.36 g/mol. Its IUPAC name is (3R)-3-(3-amino-2,6-difluorophenyl)-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3R)-3-(3-amino-2,6-difluorophenyl)-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 89095188 |
| Molecular Formula | C13H17F2N3O2S |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | (3R)-3-(3-amino-2,6-difluorophenyl)-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | CC1(C)C(N)=N[C@](C)(c2c(F)ccc(N)c2F)CS1(=O)=O |
| InChI | InChI=1S/C13H17F2N3O2S/c1-12(2)11(17)18-13(3,6-21(12,19)20)9-7(14)4-5-8(16)10(9)15/h4-5H,6,16H2,1-3H3,(H2,17,18)/t13-/m0/s1 |
| InChIKey | IRNQRCFJTGZSBQ-ZDUSSCGKSA-N |
| XLogP | 1.33 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|