C14H14F3N3O3 — CID 126682366
(4R,5R,6S)-5-fluoro-6-(1-fluorocyclopropyl)-4-(2-fluoro-5-nitrophenyl)-4-methyl-5,6-dihydro-1,3-oxazin-2-amine (PubChem CID 126682366) has the molecular formula C14H14F3N3O3 and a molecular weight of 329.28 g/mol. Its IUPAC name is (4R,5R,6S)-5-fluoro-6-(1-fluorocyclopropyl)-4-(2-fluoro-5-nitrophenyl)-4-methyl-5,6-dihydro-1,3-oxazin-2-amine.
| Compound Name | (4R,5R,6S)-5-fluoro-6-(1-fluorocyclopropyl)-4-(2-fluoro-5-nitrophenyl)-4-methyl-5,6-dihydro-1,3-oxazin-2-amine |
|---|---|
| PubChem CID | 126682366 |
| Molecular Formula | C14H14F3N3O3 |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | (4R,5R,6S)-5-fluoro-6-(1-fluorocyclopropyl)-4-(2-fluoro-5-nitrophenyl)-4-methyl-5,6-dihydro-1,3-oxazin-2-amine |
| SMILES | C[C@]1(c2cc([N+](=O)[O-])ccc2F)N=C(N)O[C@H](C2(F)CC2)[C@@H]1F |
| InChI | InChI=1S/C14H14F3N3O3/c1-13(8-6-7(20(21)22)2-3-9(8)15)10(16)11(14(17)4-5-14)23-12(18)19-13/h2-3,6,10-11H,4-5H2,1H3,(H2,18,19)/t10-,11-,13+/m0/s1 |
| InChIKey | CPXKVPOOSMDGNO-GMXVVIOVSA-N |
| XLogP | 2.50 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|