C15H14F5N3O3 — CID 89438196
(4R,4aS,7aS)-6,6-difluoro-4,7a-bis(fluoromethyl)-4-(2-fluoro-5-nitrophenyl)-5,7-dihydro-4aH-cyclopenta[e][1,3]oxazin-2-amine (PubChem CID 89438196) has the molecular formula C15H14F5N3O3 and a molecular weight of 379.29 g/mol. Its IUPAC name is (4R,4aS,7aS)-6,6-difluoro-4,7a-bis(fluoromethyl)-4-(2-fluoro-5-nitrophenyl)-5,7-dihydro-4aH-cyclopenta[e][1,3]oxazin-2-amine.
| Compound Name | (4R,4aS,7aS)-6,6-difluoro-4,7a-bis(fluoromethyl)-4-(2-fluoro-5-nitrophenyl)-5,7-dihydro-4aH-cyclopenta[e][1,3]oxazin-2-amine |
|---|---|
| PubChem CID | 89438196 |
| Molecular Formula | C15H14F5N3O3 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | (4R,4aS,7aS)-6,6-difluoro-4,7a-bis(fluoromethyl)-4-(2-fluoro-5-nitrophenyl)-5,7-dihydro-4aH-cyclopenta[e][1,3]oxazin-2-amine |
| SMILES | NC1=N[C@@](CF)(c2cc([N+](=O)[O-])ccc2F)[C@@H]2CC(F)(F)C[C@]2(CF)O1 |
| InChI | InChI=1S/C15H14F5N3O3/c16-6-13-5-14(19,20)4-11(13)15(7-17,22-12(21)26-13)9-3-8(23(24)25)1-2-10(9)18/h1-3,11H,4-7H2,(H2,21,22)/t11-,13-,15+/m1/s1 |
| InChIKey | OOBSTKWQZSUVGN-KYOSRNDESA-N |
| XLogP | 3.00 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|