C14H15F2N3O4 — CID 159224190
(4S,4aS,8aR)-4-(fluoromethyl)-4-(2-fluoro-5-nitrophenyl)-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-e][1,3]oxazin-2-amine (PubChem CID 159224190) has the molecular formula C14H15F2N3O4 and a molecular weight of 327.29 g/mol. Its IUPAC name is (4S,4aS,8aR)-4-(fluoromethyl)-4-(2-fluoro-5-nitrophenyl)-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-e][1,3]oxazin-2-amine.
| Compound Name | (4S,4aS,8aR)-4-(fluoromethyl)-4-(2-fluoro-5-nitrophenyl)-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-e][1,3]oxazin-2-amine |
|---|---|
| PubChem CID | 159224190 |
| Molecular Formula | C14H15F2N3O4 |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | (4S,4aS,8aR)-4-(fluoromethyl)-4-(2-fluoro-5-nitrophenyl)-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-e][1,3]oxazin-2-amine |
| SMILES | NC1=N[C@](CF)(c2cc([N+](=O)[O-])ccc2F)[C@H]2COCC[C@H]2O1 |
| InChI | InChI=1S/C14H15F2N3O4/c15-7-14(9-5-8(19(20)21)1-2-11(9)16)10-6-22-4-3-12(10)23-13(17)18-14/h1-2,5,10,12H,3-4,6-7H2,(H2,17,18)/t10-,12+,14+/m0/s1 |
| InChIKey | QEXXYVPPIIYTLL-ZKYQVNSYSA-N |
| XLogP | 1.65 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|