C20H21F2N5O4 — CID 166685719
N-[3-[2-amino-4-(fluoromethyl)-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-e][1,3]oxazin-4-yl]-4-fluorophenyl]-5-methoxypyrazine-2-carboxamide (PubChem CID 166685719) has the molecular formula C20H21F2N5O4 and a molecular weight of 433.42 g/mol. Its IUPAC name is N-[3-[2-amino-4-(fluoromethyl)-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-e][1,3]oxazin-4-yl]-4-fluorophenyl]-5-methoxypyrazine-2-carboxamide.
| Compound Name | N-[3-[2-amino-4-(fluoromethyl)-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-e][1,3]oxazin-4-yl]-4-fluorophenyl]-5-methoxypyrazine-2-carboxamide |
|---|---|
| PubChem CID | 166685719 |
| Molecular Formula | C20H21F2N5O4 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | N-[3-[2-amino-4-(fluoromethyl)-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-e][1,3]oxazin-4-yl]-4-fluorophenyl]-5-methoxypyrazine-2-carboxamide |
| SMILES | COc1cnc(C(=O)Nc2ccc(F)c(C3(CF)N=C(N)OC4CCOCC43)c2)cn1 |
| InChI | InChI=1S/C20H21F2N5O4/c1-29-17-8-24-15(7-25-17)18(28)26-11-2-3-14(22)12(6-11)20(10-21)13-9-30-5-4-16(13)31-19(23)27-20/h2-3,6-8,13,16H,4-5,9-10H2,1H3,(H2,23,27)(H,26,28) |
| InChIKey | OSFHPOAOIIYIOC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |