C22H24F3N5O4 — CID 166685721
N-[3-[2-amino-5-ethyl-4-(fluoromethyl)-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-e][1,3]oxazin-4-yl]-4-fluorophenyl]-5-(fluoromethoxy)pyrazine-2-carboxamide (PubChem CID 166685721) has the molecular formula C22H24F3N5O4 and a molecular weight of 479.46 g/mol. Its IUPAC name is N-[3-[2-amino-5-ethyl-4-(fluoromethyl)-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-e][1,3]oxazin-4-yl]-4-fluorophenyl]-5-(fluoromethoxy)pyrazine-2-carboxamide.
| Compound Name | N-[3-[2-amino-5-ethyl-4-(fluoromethyl)-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-e][1,3]oxazin-4-yl]-4-fluorophenyl]-5-(fluoromethoxy)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 166685721 |
| Molecular Formula | C22H24F3N5O4 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | N-[3-[2-amino-5-ethyl-4-(fluoromethyl)-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-e][1,3]oxazin-4-yl]-4-fluorophenyl]-5-(fluoromethoxy)pyrazine-2-carboxamide |
| SMILES | CCC1OCCC2OC(N)=NC(CF)(c3cc(NC(=O)c4cnc(OCF)cn4)ccc3F)C12 |
| InChI | InChI=1S/C22H24F3N5O4/c1-2-16-19-17(5-6-32-16)34-21(26)30-22(19,10-23)13-7-12(3-4-14(13)25)29-20(31)15-8-28-18(9-27-15)33-11-24/h3-4,7-9,16-17,19H,2,5-6,10-11H2,1H3,(H2,26,30)(H,29,31) |
| InChIKey | BSRCDFPNSALFHV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |