C21H23ClFN5O4 — CID 166685708
N-[3-[(4S,4aS,7R,8aR)-2-amino-4-(fluoromethyl)-7-methyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-e][1,3]oxazin-4-yl]-4-chlorophenyl]-5-methoxypyrazine-2-carboxamide (PubChem CID 166685708) has the molecular formula C21H23ClFN5O4 and a molecular weight of 463.90 g/mol. Its IUPAC name is N-[3-[(4S,4aS,7R,8aR)-2-amino-4-(fluoromethyl)-7-methyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-e][1,3]oxazin-4-yl]-4-chlorophenyl]-5-methoxypyrazine-2-carboxamide.
| Compound Name | N-[3-[(4S,4aS,7R,8aR)-2-amino-4-(fluoromethyl)-7-methyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-e][1,3]oxazin-4-yl]-4-chlorophenyl]-5-methoxypyrazine-2-carboxamide |
|---|---|
| PubChem CID | 166685708 |
| Molecular Formula | C21H23ClFN5O4 |
| Molecular Weight | 463.90 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | N-[3-[(4S,4aS,7R,8aR)-2-amino-4-(fluoromethyl)-7-methyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-e][1,3]oxazin-4-yl]-4-chlorophenyl]-5-methoxypyrazine-2-carboxamide |
| SMILES | COc1cnc(C(=O)Nc2ccc(Cl)c([C@@]3(CF)N=C(N)O[C@@H]4C[C@@H](C)OC[C@@H]43)c2)cn1 |
| InChI | InChI=1S/C21H23ClFN5O4/c1-11-5-17-14(9-31-11)21(10-23,28-20(24)32-17)13-6-12(3-4-15(13)22)27-19(29)16-7-26-18(30-2)8-25-16/h3-4,6-8,11,14,17H,5,9-10H2,1-2H3,(H2,24,28)(H,27,29)/t11-,14+,17-,21-/m1/s1 |
| InChIKey | IHFWWLNJKOKOAJ-PVYVRIBNSA-N |
| XLogP | 2.69 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.90 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |