C19H21FN6O5S — CID 89036616
N-[3-[(4aR)-3-amino-2-methyl-1,1-dioxo-5,6,8,8a-tetrahydropyrano[4,3-e][1,2,4]thiadiazin-4a-yl]-4-fluorophenyl]-5-methoxypyrazine-2-carboxamide (PubChem CID 89036616) has the molecular formula C19H21FN6O5S and a molecular weight of 464.48 g/mol. Its IUPAC name is N-[3-[(4aR)-3-amino-2-methyl-1,1-dioxo-5,6,8,8a-tetrahydropyrano[4,3-e][1,2,4]thiadiazin-4a-yl]-4-fluorophenyl]-5-methoxypyrazine-2-carboxamide.
| Compound Name | N-[3-[(4aR)-3-amino-2-methyl-1,1-dioxo-5,6,8,8a-tetrahydropyrano[4,3-e][1,2,4]thiadiazin-4a-yl]-4-fluorophenyl]-5-methoxypyrazine-2-carboxamide |
|---|---|
| PubChem CID | 89036616 |
| Molecular Formula | C19H21FN6O5S |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | N-[3-[(4aR)-3-amino-2-methyl-1,1-dioxo-5,6,8,8a-tetrahydropyrano[4,3-e][1,2,4]thiadiazin-4a-yl]-4-fluorophenyl]-5-methoxypyrazine-2-carboxamide |
| SMILES | COc1cnc(C(=O)Nc2ccc(F)c([C@]34CCOCC3S(=O)(=O)N(C)C(N)=N4)c2)cn1 |
| InChI | InChI=1S/C19H21FN6O5S/c1-26-18(21)25-19(5-6-31-10-15(19)32(26,28)29)12-7-11(3-4-13(12)20)24-17(27)14-8-23-16(30-2)9-22-14/h3-4,7-9,15H,5-6,10H2,1-2H3,(H2,21,25)(H,24,27)/t15?,19-/m1/s1 |
| InChIKey | HQHSZOKRCQHUDF-XCWJXAQQSA-N |
| XLogP | 0.45 |
| TPSA | 149.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |