C19H22N6O5S — CID 123562982
N-[3-(3-amino-2-methyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[3,4-e][1,2,4]thiadiazin-4a-yl)phenyl]-5-methoxypyrazine-2-carboxamide (PubChem CID 123562982) has the molecular formula C19H22N6O5S and a molecular weight of 446.49 g/mol. Its IUPAC name is N-[3-(3-amino-2-methyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[3,4-e][1,2,4]thiadiazin-4a-yl)phenyl]-5-methoxypyrazine-2-carboxamide.
| Compound Name | N-[3-(3-amino-2-methyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[3,4-e][1,2,4]thiadiazin-4a-yl)phenyl]-5-methoxypyrazine-2-carboxamide |
|---|---|
| PubChem CID | 123562982 |
| Molecular Formula | C19H22N6O5S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | N-[3-(3-amino-2-methyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[3,4-e][1,2,4]thiadiazin-4a-yl)phenyl]-5-methoxypyrazine-2-carboxamide |
| SMILES | COc1cnc(C(=O)Nc2cccc(C34COCCC3S(=O)(=O)N(C)C(N)=N4)c2)cn1 |
| InChI | InChI=1S/C19H22N6O5S/c1-25-18(20)24-19(11-30-7-6-15(19)31(25,27)28)12-4-3-5-13(8-12)23-17(26)14-9-22-16(29-2)10-21-14/h3-5,8-10,15H,6-7,11H2,1-2H3,(H2,20,24)(H,23,26) |
| InChIKey | CQIIPTOPMVVRGM-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 149.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |