C17H18ClN5O5S2 — CID 71469016
5-[(4aS)-3-amino-2-methyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl]-4-chloro-N-(6-methoxy-2-pyridinyl)thiophene-2-carboxamide (PubChem CID 71469016) has the molecular formula C17H18ClN5O5S2 and a molecular weight of 471.95 g/mol. Its IUPAC name is 5-[(4aS)-3-amino-2-methyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl]-4-chloro-N-(6-methoxy-2-pyridinyl)thiophene-2-carboxamide.
| Compound Name | 5-[(4aS)-3-amino-2-methyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl]-4-chloro-N-(6-methoxy-2-pyridinyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 71469016 |
| Molecular Formula | C17H18ClN5O5S2 |
| Molecular Weight | 471.95 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | 5-[(4aS)-3-amino-2-methyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl]-4-chloro-N-(6-methoxy-2-pyridinyl)thiophene-2-carboxamide |
| SMILES | COc1cccc(NC(=O)c2cc(Cl)c([C@]34COCC3S(=O)(=O)N(C)C(N)=N4)s2)n1 |
| InChI | InChI=1S/C17H18ClN5O5S2/c1-23-16(19)22-17(8-28-7-11(17)30(23,25)26)14-9(18)6-10(29-14)15(24)21-12-4-3-5-13(20-12)27-2/h3-6,11H,7-8H2,1-2H3,(H2,19,22)(H,20,21,24)/t11?,17-/m0/s1 |
| InChIKey | JPZOHTXCTHSDMU-KLLZUTDZSA-N |
| XLogP | 1.24 |
| TPSA | 136.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.95 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |