C21H22ClFN4O4S — CID 123749121
N-[3-(3-amino-2-methyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl)-4-fluorophenyl]-4-chloro-2-ethylbenzamide (PubChem CID 123749121) has the molecular formula C21H22ClFN4O4S and a molecular weight of 480.95 g/mol. Its IUPAC name is N-[3-(3-amino-2-methyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl)-4-fluorophenyl]-4-chloro-2-ethylbenzamide.
| Compound Name | N-[3-(3-amino-2-methyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl)-4-fluorophenyl]-4-chloro-2-ethylbenzamide |
|---|---|
| PubChem CID | 123749121 |
| Molecular Formula | C21H22ClFN4O4S |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | N-[3-(3-amino-2-methyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl)-4-fluorophenyl]-4-chloro-2-ethylbenzamide |
| SMILES | CCc1cc(Cl)ccc1C(=O)Nc1ccc(F)c(C23COCC2S(=O)(=O)N(C)C(N)=N3)c1 |
| InChI | InChI=1S/C21H22ClFN4O4S/c1-3-12-8-13(22)4-6-15(12)19(28)25-14-5-7-17(23)16(9-14)21-11-31-10-18(21)32(29,30)27(2)20(24)26-21/h4-9,18H,3,10-11H2,1-2H3,(H2,24,26)(H,25,28) |
| InChIKey | XRNDREXJXKKHPK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |