C18H19F2N5O4S — CID 123677529
[3-(3-amino-2-methyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl)-4-fluoroanilino]-(5-fluoro-2-pyridinyl)methanol (PubChem CID 123677529) has the molecular formula C18H19F2N5O4S and a molecular weight of 439.44 g/mol. Its IUPAC name is [3-(3-amino-2-methyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl)-4-fluoroanilino]-(5-fluoro-2-pyridinyl)methanol.
| Compound Name | [3-(3-amino-2-methyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl)-4-fluoroanilino]-(5-fluoro-2-pyridinyl)methanol |
|---|---|
| PubChem CID | 123677529 |
| Molecular Formula | C18H19F2N5O4S |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | [3-(3-amino-2-methyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl)-4-fluoroanilino]-(5-fluoro-2-pyridinyl)methanol |
| SMILES | CN1C(N)=NC2(c3cc(NC(O)c4ccc(F)cn4)ccc3F)COCC2S1(=O)=O |
| InChI | InChI=1S/C18H19F2N5O4S/c1-25-17(21)24-18(9-29-8-15(18)30(25,27)28)12-6-11(3-4-13(12)20)23-16(26)14-5-2-10(19)7-22-14/h2-7,15-16,23,26H,8-9H2,1H3,(H2,21,24) |
| InChIKey | BFNCKWSNMRORPE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 130.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|