C20H21F4N5O3S — CID 137355689
N-[3-(3-amino-7,7-difluoro-1,1-dihydroxy-2-methyl-5,6,8,8a-tetrahydro-1λ4,2,4-benzothiadiazin-4a-yl)-4-fluorophenyl]-5-fluoropyridine-2-carboxamide (PubChem CID 137355689) has the molecular formula C20H21F4N5O3S and a molecular weight of 487.48 g/mol. Its IUPAC name is N-[3-(3-amino-7,7-difluoro-1,1-dihydroxy-2-methyl-5,6,8,8a-tetrahydro-1λ4,2,4-benzothiadiazin-4a-yl)-4-fluorophenyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[3-(3-amino-7,7-difluoro-1,1-dihydroxy-2-methyl-5,6,8,8a-tetrahydro-1λ4,2,4-benzothiadiazin-4a-yl)-4-fluorophenyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 137355689 |
| Molecular Formula | C20H21F4N5O3S |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | N-[3-(3-amino-7,7-difluoro-1,1-dihydroxy-2-methyl-5,6,8,8a-tetrahydro-1λ4,2,4-benzothiadiazin-4a-yl)-4-fluorophenyl]-5-fluoropyridine-2-carboxamide |
| SMILES | CN1C(N)=NC2(c3cc(NC(=O)c4ccc(F)cn4)ccc3F)CCC(F)(F)CC2S1(O)O |
| InChI | InChI=1S/C20H21F4N5O3S/c1-29-18(25)28-20(7-6-19(23,24)9-16(20)33(29,31)32)13-8-12(3-4-14(13)22)27-17(30)15-5-2-11(21)10-26-15/h2-5,8,10,16,31-32H,6-7,9H2,1H3,(H2,25,28)(H,27,30) |
| InChIKey | NRCKTUZJPGDJKV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 124.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |